CAS 1309081-43-3 appears in our catalog under these names: tert-Butyl 4-(1-methyl-1h-pyrazol-4-yl)-3-oxopiperazine-1-carboxylate, 95%, tert-Butyl 4-(1-methyl-1H-pyrazol-4-yl)-3-oxopiperazine-1-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
Tert-butyl 4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboxylate (CAS 1309081-43-3) is a chemical compound with the molecular formula C13H20N4O3 and a molecular weight of 280.32 g/mol. IUPAC name: tert-butyl 4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboxylate. InChIKey: SKUPXVLJNBBUJN-UHFFFAOYSA-N.
| Molecular formula | C13H20N4O3 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | tert-butyl 4-(1-methylpyrazol-4-yl)-3-oxopiperazine-1-carboxylate |
| InChIKey | SKUPXVLJNBBUJN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)C1)C2=CN(N=C2)C |
Computed by PubChem (NCBI)