CAS 1185995-26-9 appears in our catalog under these names: (+/-)-Lisofylline-d6, >95% (HPLC), (+/-)-Lisofylline-d6, (±)-Lisofylline-d6. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 50mg, 1 mg.
1-(5-hydroxyhexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione (CAS 1185995-26-9) is a chemical compound with the molecular formula C13H20N4O3 and a molecular weight of 286.36 g/mol. IUPAC name: 1-(5-hydroxyhexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione. InChIKey: NSMXQKNUPPXBRG-XERRXZQWSA-N.
| Molecular formula | C13H20N4O3 |
|---|---|
| Molecular weight | 286.36 g/mol |
| IUPAC name | 1-(5-hydroxyhexyl)-3,7-bis(trideuteriomethyl)purine-2,6-dione |
| InChIKey | NSMXQKNUPPXBRG-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC2=C1C(=O)N(C(=O)N2C([2H])([2H])[2H])CCCCC(C)O |
Computed by PubChem (NCBI)