Products 730949-70-9

CAS 730949-70-9 is the registry number for 3-Butyl-8-hydroxymethyl-7-propyl-3,7-dihydro-purine-2,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-butyl-8-(hydroxymethyl)-7-propylpurine-2,6-dione (CAS 730949-70-9) is a chemical compound with the molecular formula C13H20N4O3 and a molecular weight of 280.32 g/mol. IUPAC name: 3-butyl-8-(hydroxymethyl)-7-propylpurine-2,6-dione. InChIKey: IYFNZUXNWPIACG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20N4O3
Molecular weight280.32 g/mol
IUPAC name3-butyl-8-(hydroxymethyl)-7-propylpurine-2,6-dione
InChIKeyIYFNZUXNWPIACG-UHFFFAOYSA-N
SMILESCCCCN1C2=C(C(=O)NC1=O)N(C(=N2)CO)CCC

Computed by PubChem (NCBI)