Products 13194-60-0
CAS 13194-60-0 appears in our catalog under these names: 3-Chloro-4-nitropyridine 97%, 3-Chloro-4-nitropyridine, 96%, 96%, 3-Chloro-4-nitropyridine, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g.
3-chloro-4-nitropyridine (CAS 13194-60-0) is a chemical compound with the molecular formula C5H3ClN2O2 and a molecular weight of 158.54 g/mol. IUPAC name: 3-chloro-4-nitropyridine. InChIKey: CWLVEHGKYCYAIO-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O2 |
|---|---|
| Molecular weight | 158.54 g/mol |
| IUPAC name | 3-chloro-4-nitropyridine |
| InChIKey | CWLVEHGKYCYAIO-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)