Products 1309283-11-1
CAS 1309283-11-1 is the registry number for Phenoxybenzamine-d5. Offered by: MedChemExpress. Available pack sizes: 1 mg.
N-(2-chloroethyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-1-phenoxypropan-2-amine (CAS 1309283-11-1) is a chemical compound with the molecular formula C18H22ClNO and a molecular weight of 308.9 g/mol. IUPAC name: N-(2-chloroethyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-1-phenoxypropan-2-amine. InChIKey: QZVCTJOXCFMACW-FPWDVLCWSA-N.
| Molecular formula | C18H22ClNO |
|---|---|
| Molecular weight | 308.9 g/mol |
| IUPAC name | N-(2-chloroethyl)-N-[(2,3,4,5,6-pentadeuteriophenyl)methyl]-1-phenoxypropan-2-amine |
| InChIKey | QZVCTJOXCFMACW-FPWDVLCWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])CN(CCCl)C(C)COC2=CC=CC=C2)[2H])[2H] |
Computed by PubChem (NCBI)