CAS 1217097-50-1 is the registry number for Pipradrol-d5 Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2,3,4,5,6-pentadeuteriophenyl)-phenyl-piperidin-2-ylmethanol;hydrochloride (CAS 1217097-50-1) is a chemical compound with the molecular formula C18H22ClNO and a molecular weight of 308.9 g/mol. IUPAC name: (2,3,4,5,6-pentadeuteriophenyl)-phenyl-piperidin-2-ylmethanol;hydrochloride. InChIKey: KIFIYUHFHGSNHL-SQJASTRZSA-N.
| Molecular formula | C18H22ClNO |
|---|---|
| Molecular weight | 308.9 g/mol |
| IUPAC name | (2,3,4,5,6-pentadeuteriophenyl)-phenyl-piperidin-2-ylmethanol;hydrochloride |
| InChIKey | KIFIYUHFHGSNHL-SQJASTRZSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2CCCCN2)(C3=CC=CC=C3)O)[2H])[2H].Cl |
Computed by PubChem (NCBI)