CAS 65214-86-0 appears in our catalog under these names: Ebastine EP Impurity C HCl, Ebastine EP Impurity C, 4-Diphenylmethoxypiperidine hydrochloride, >95% (HPLC), 4-(Diphenylmethoxy)piperidine Hydrochloride, 4-(Diphenylmethoxy)piperidinium chloride. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 25mg, 1000mg, 250mg, 1g, 5g, 25g.
4-benzhydryloxypiperidine;hydrochloride (CAS 65214-86-0) is a chemical compound with the molecular formula C18H22ClNO and a molecular weight of 303.8 g/mol. IUPAC name: 4-benzhydryloxypiperidine;hydrochloride. InChIKey: HXROHDYGZFFVMO-UHFFFAOYSA-N.
| Molecular formula | C18H22ClNO |
|---|---|
| Molecular weight | 303.8 g/mol |
| IUPAC name | 4-benzhydryloxypiperidine;hydrochloride |
| InChIKey | HXROHDYGZFFVMO-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC(C2=CC=CC=C2)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)