CAS 130952-46-4 appears in our catalog under these names: Ozagrel Sodium, 98+%, Ozagrel sodium (OKY–046 sodium), (E/Z)-Ozagrel (sodium). Offered by: AmBeed, GLPBio, MedChemExpress. Available pack sizes: 5g, 10mg, Get quote.
Sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate (CAS 130952-46-4) is a chemical compound with the molecular formula C13H11N2NaO2 and a molecular weight of 250.23 g/mol. IUPAC name: sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate. InChIKey: NCNYJCOBUTXCBR-IPZCTEOASA-M.
| Molecular formula | C13H11N2NaO2 |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate |
| InChIKey | NCNYJCOBUTXCBR-IPZCTEOASA-M |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)/C=C/C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)