CAS 78712-44-4 appears in our catalog under these names: Ozagrel Impurity 33, Ozagrel Impurity 20. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Sodium (E)-3-[3-(imidazol-1-ylmethyl)phenyl]prop-2-enoate (CAS 78712-44-4) is a chemical compound with the molecular formula C13H11N2NaO2 and a molecular weight of 250.23 g/mol. IUPAC name: sodium (E)-3-[3-(imidazol-1-ylmethyl)phenyl]prop-2-enoate. InChIKey: CUHCIBOVTXNWJX-FXRZFVDSSA-M.
| Molecular formula | C13H11N2NaO2 |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | sodium (E)-3-[3-(imidazol-1-ylmethyl)phenyl]prop-2-enoate |
| InChIKey | CUHCIBOVTXNWJX-FXRZFVDSSA-M |
| SMILES | C1=CC(=CC(=C1)/C=C/C(=O)[O-])CN2C=CN=C2.[Na+] |
Computed by PubChem (NCBI)