CAS 189224-26-8 appears in our catalog under these names: Ozagrel sodium, 95%, Ozagrel sodium, 95+%, Ozagrel Sodium, Ozagrel Sodium, >98.0%(HPLC)(T), Ozagrel Sodium, 95%+, 95%+. Offered by: Combi-blocks, AmBeed, TargetMol, Biosynth, TCI. Available pack sizes: 5g, 1g, 250mg, 10mg, 5mg, 500mg, 1000mg, 100 mg.
Sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate (CAS 189224-26-8) is a chemical compound with the molecular formula C13H11N2NaO2 and a molecular weight of 250.23 g/mol. IUPAC name: sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate. InChIKey: NCNYJCOBUTXCBR-IPZCTEOASA-M.
| Molecular formula | C13H11N2NaO2 |
|---|---|
| Molecular weight | 250.23 g/mol |
| IUPAC name | sodium (E)-3-[4-(imidazol-1-ylmethyl)phenyl]prop-2-enoate |
| InChIKey | NCNYJCOBUTXCBR-IPZCTEOASA-M |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)/C=C/C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)