CAS 1309666-78-1 appears in our catalog under these names: 2-(2-(tert-Butoxycarbonyl)ethoxy)ethyl 4-methylbenzenesulfonate, 95%, Tos-PEG2-Boc, Tos–PEG2–Boc, Tos-PEG2-Boc 95%, tert-Butyl 3-(2-(tosyloxy)ethoxy)propanoate, 95%, 95%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5mg, 10mg, 100mg, 50mg, 500mg, 500 mg.
Tert-butyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]propanoate (CAS 1309666-78-1) is a chemical compound with the molecular formula C16H24O6S and a molecular weight of 344.4 g/mol. IUPAC name: tert-butyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]propanoate. InChIKey: OVLSSENVXOKYAD-UHFFFAOYSA-N.
| Molecular formula | C16H24O6S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | tert-butyl 3-[2-(4-methylphenyl)sulfonyloxyethoxy]propanoate |
| InChIKey | OVLSSENVXOKYAD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)