Products 84183-97-1

CAS 84183-97-1 is the registry number for Toluene-4-sulfonic acid 2-[2-(2-allyloxy-ethoxy)-ethoxy]-ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS 84183-97-1) is a chemical compound with the molecular formula C16H24O6S and a molecular weight of 344.4 g/mol. IUPAC name: 2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: QLTZYXHODZUIPE-UHFFFAOYSA-N.

Identity
Molecular formulaC16H24O6S
Molecular weight344.4 g/mol
IUPAC name2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethyl 4-methylbenzenesulfonate
InChIKeyQLTZYXHODZUIPE-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCC=C

Computed by PubChem (NCBI)