CAS 69502-32-5 appears in our catalog under these names: Tos-PEG2-THP, 97%, Tos–PEG2–THP, 2-(2-((Tetrahydro-2H-pyran-2-yl)oxy)ethoxy)ethyl 4-methylbenzenesulfonate, 95%, 95%, Tos-PEG2-THP, 95.31%, Tos-PEG2-THP, 95%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 250mg, 1g, 1 g, 100 mg, 250 mg.
2-[2-(oxan-2-yloxy)ethoxy]ethyl 4-methylbenzenesulfonate (CAS 69502-32-5) is a chemical compound with the molecular formula C16H24O6S and a molecular weight of 344.4 g/mol. IUPAC name: 2-[2-(oxan-2-yloxy)ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: MYIMMUFXKWKAID-UHFFFAOYSA-N.
| Molecular formula | C16H24O6S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-[2-(oxan-2-yloxy)ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | MYIMMUFXKWKAID-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOC2CCCCO2 |
Computed by PubChem (NCBI)