CAS 1309774-04-6 appears in our catalog under these names: 7-Bromo-1,5-naphthyridin-2-amine, 95%, 7-Bromo-1,5-naphthyridin-2-amine, 98%, 98%, 7-BROMO-1,5-NAPHTHYRIDIN-2-AMINE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
7-bromo-1,5-naphthyridin-2-amine (CAS 1309774-04-6) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 7-bromo-1,5-naphthyridin-2-amine. InChIKey: WONDVTGZCODVDX-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 7-bromo-1,5-naphthyridin-2-amine |
| InChIKey | WONDVTGZCODVDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=CC(=C2)Br)N |
Computed by PubChem (NCBI)