Products 1309887-73-7
CAS 1309887-73-7 appears in our catalog under these names: 4-(3-Bromophenyl)-3-methyl-1H-pyrazol-5-amine, 96%, 4-(3-Bromophenyl)-3-methyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 100mg, 2,5g.
4-(3-bromophenyl)-5-methyl-1H-pyrazol-3-amine (CAS 1309887-73-7) is a chemical compound with the molecular formula C10H10BrN3 and a molecular weight of 252.11 g/mol. IUPAC name: 4-(3-bromophenyl)-5-methyl-1H-pyrazol-3-amine. InChIKey: ZKGMEKBNNPAEPX-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3 |
|---|---|
| Molecular weight | 252.11 g/mol |
| IUPAC name | 4-(3-bromophenyl)-5-methyl-1H-pyrazol-3-amine |
| InChIKey | ZKGMEKBNNPAEPX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)N)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)