CAS 13099-73-5 appears in our catalog under these names: 6-Chloro-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 95+%, 6-Chloro-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 6-Chloro-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 95%, 95%, 6-Chloro-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 25mg, 100mg, 250mg.
6-chloro-2,2-dimethyl-3H-inden-1-one (CAS 13099-73-5) is a chemical compound with the molecular formula C11H11ClO and a molecular weight of 194.66 g/mol. IUPAC name: 6-chloro-2,2-dimethyl-3H-inden-1-one. InChIKey: XFZYJZIKQGZVES-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO |
|---|---|
| Molecular weight | 194.66 g/mol |
| IUPAC name | 6-chloro-2,2-dimethyl-3H-inden-1-one |
| InChIKey | XFZYJZIKQGZVES-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C1=O)C=C(C=C2)Cl)C |
Computed by PubChem (NCBI)