CAS 1309981-43-8 is the registry number for 4-(2-Hydroxypropan-2-yl)pyridin-3-ylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
[4-(2-hydroxypropan-2-yl)-3-pyridinyl]boronic acid (CAS 1309981-43-8) is a chemical compound with the molecular formula C8H12BNO3 and a molecular weight of 181.00 g/mol. IUPAC name: [4-(2-hydroxypropan-2-yl)-3-pyridinyl]boronic acid. InChIKey: LDYHASLAANQOHU-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO3 |
|---|---|
| Molecular weight | 181.00 g/mol |
| IUPAC name | [4-(2-hydroxypropan-2-yl)-3-pyridinyl]boronic acid |
| InChIKey | LDYHASLAANQOHU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CN=C1)C(C)(C)O)(O)O |
Computed by PubChem (NCBI)