CAS 1451391-75-5 appears in our catalog under these names: 6-Ethoxy-2-methylpyridin-3-ylboronic acid, 95%, (6-Ethoxy-2-methylpyridin-3-yl)boronic acid, 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
(6-ethoxy-2-methyl-3-pyridinyl)boronic acid (CAS 1451391-75-5) is a chemical compound with the molecular formula C8H12BNO3 and a molecular weight of 181.00 g/mol. IUPAC name: (6-ethoxy-2-methyl-3-pyridinyl)boronic acid. InChIKey: DGYSVJLCCSUTNY-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO3 |
|---|---|
| Molecular weight | 181.00 g/mol |
| IUPAC name | (6-ethoxy-2-methyl-3-pyridinyl)boronic acid |
| InChIKey | DGYSVJLCCSUTNY-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)OCC)C)(O)O |
Computed by PubChem (NCBI)