CAS 850991-41-2 appears in our catalog under these names: (5-Isopropoxy-3-pyridinyl)boronic acid, 95%, (5-Isopropoxypyridin-3-yl)boronic acid 95+%, (5-Isopropoxy-3-pyridinyl)boronic acid, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
(5-propan-2-yloxy-3-pyridinyl)boronic acid (CAS 850991-41-2) is a chemical compound with the molecular formula C8H12BNO3 and a molecular weight of 181.00 g/mol. IUPAC name: (5-propan-2-yloxy-3-pyridinyl)boronic acid. InChIKey: XQHUPBAXLPBXOT-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO3 |
|---|---|
| Molecular weight | 181.00 g/mol |
| IUPAC name | (5-propan-2-yloxy-3-pyridinyl)boronic acid |
| InChIKey | XQHUPBAXLPBXOT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)OC(C)C)(O)O |
Computed by PubChem (NCBI)