Products 1309982-56-6
CAS 1309982-56-6 appears in our catalog under these names: (5-Amino-6-methoxypyridin-3-yl)boronic acid, 97%, 97%, (5-Amino-6-methoxypyridin-3-yl)boronic acid. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg.
(5-amino-6-methoxy-3-pyridinyl)boronic acid (CAS 1309982-56-6) is a chemical compound with the molecular formula C6H9BN2O3 and a molecular weight of 167.96 g/mol. IUPAC name: (5-amino-6-methoxy-3-pyridinyl)boronic acid. InChIKey: SIAAGSWOGRZEKL-UHFFFAOYSA-N.
| Molecular formula | C6H9BN2O3 |
|---|---|
| Molecular weight | 167.96 g/mol |
| IUPAC name | (5-amino-6-methoxy-3-pyridinyl)boronic acid |
| InChIKey | SIAAGSWOGRZEKL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)OC)N)(O)O |
Computed by PubChem (NCBI)