CAS 2225155-17-7 is the registry number for 2–Hydroxy–4–ethylpyrimidine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(6-ethyl-2-oxo-1H-pyrimidin-5-yl)boronic acid (CAS 2225155-17-7) is a chemical compound with the molecular formula C6H9BN2O3 and a molecular weight of 167.96 g/mol. IUPAC name: (6-ethyl-2-oxo-1H-pyrimidin-5-yl)boronic acid. InChIKey: UIVSPOIVOSPDBJ-UHFFFAOYSA-N.
| Molecular formula | C6H9BN2O3 |
|---|---|
| Molecular weight | 167.96 g/mol |
| IUPAC name | (6-ethyl-2-oxo-1H-pyrimidin-5-yl)boronic acid |
| InChIKey | UIVSPOIVOSPDBJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(NC(=O)N=C1)CC)(O)O |
Computed by PubChem (NCBI)