Products 2241877-11-0
CAS 2241877-11-0 is the registry number for (2–(methoxy–d3)–4–(methyl–d3)pyrimidin–5–yl)boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(trideuteriomethoxy)-4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid (CAS 2241877-11-0) is a chemical compound with the molecular formula C6H9BN2O3 and a molecular weight of 174.00 g/mol. IUPAC name: [2-(trideuteriomethoxy)-4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid. InChIKey: GIVNHTDWOWBEIW-WFGJKAKNSA-N.
| Molecular formula | C6H9BN2O3 |
|---|---|
| Molecular weight | 174.00 g/mol |
| IUPAC name | [2-(trideuteriomethoxy)-4-(trideuteriomethyl)pyrimidin-5-yl]boronic acid |
| InChIKey | GIVNHTDWOWBEIW-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=NC(=NC=C1B(O)O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)