CAS 1309982-57-7 appears in our catalog under these names: (6–Ethoxy–5–fluoropyridin–3–yl)boronic acid, 2-Ethoxy-3-fluoropyridine-5-boronic acid, 95%, 95%, (6-Ethoxy-5-fluoropyridin-3-yl)boronic acid, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(6-ethoxy-5-fluoro-3-pyridinyl)boronic acid (CAS 1309982-57-7) is a chemical compound with the molecular formula C7H9BFNO3 and a molecular weight of 184.96 g/mol. IUPAC name: (6-ethoxy-5-fluoro-3-pyridinyl)boronic acid. InChIKey: SMQWQXHLVIJJQY-UHFFFAOYSA-N.
| Molecular formula | C7H9BFNO3 |
|---|---|
| Molecular weight | 184.96 g/mol |
| IUPAC name | (6-ethoxy-5-fluoro-3-pyridinyl)boronic acid |
| InChIKey | SMQWQXHLVIJJQY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)OCC)F)(O)O |
Computed by PubChem (NCBI)