CAS 131-09-9 appears in our catalog under these names: 2-Chloroanthraquinone, 98%, 2-Chloroanthraquinone, 99%, 2-Chloroanthraquinone/ 97%, 2–Chloroanthraquinone, 2-Chloroanthraquinone, >99.0%(GC). Offered by: Combi-blocks, AmBeed, Chemat, GLPBio, TCI. Available pack sizes: 1g, 25g, 5g, 500g, 100g, 250G, 50g, 75g.
2-chloroanthracene-9,10-dione (CAS 131-09-9) is a chemical compound with the molecular formula C14H7ClO2 and a molecular weight of 242.65 g/mol. IUPAC name: 2-chloroanthracene-9,10-dione. InChIKey: FPKCTSIVDAWGFA-UHFFFAOYSA-N.
| Molecular formula | C14H7ClO2 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | 2-chloroanthracene-9,10-dione |
| InChIKey | FPKCTSIVDAWGFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)Cl |
Computed by PubChem (NCBI)