CAS 82-44-0 appears in our catalog under these names: 1-Chloroanthraquinone, 1–Chloroanthraquinone, 1-Chloroanthraquinone, >98.0%(GC), 1-Chloroanthraquinone, 98%, 1-Chloroanthraquinone 98%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 50g, 5g, 100g, 500g, 1000g, 1kg.
1-chloroanthracene-9,10-dione (CAS 82-44-0) is a chemical compound with the molecular formula C14H7ClO2 and a molecular weight of 242.65 g/mol. IUPAC name: 1-chloroanthracene-9,10-dione. InChIKey: BOCJQSFSGAZAPQ-UHFFFAOYSA-N.
| Molecular formula | C14H7ClO2 |
|---|---|
| Molecular weight | 242.65 g/mol |
| IUPAC name | 1-chloroanthracene-9,10-dione |
| InChIKey | BOCJQSFSGAZAPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=CC=C3)Cl |
Computed by PubChem (NCBI)