Products 55341-62-3

CAS 55341-62-3 appears in our catalog under these names: 9-Fluorenone-1-carbonyl chloride, 95%, 9-Oxo-9H-fluorene-1-carbonyl chloride 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 10g, 5g, 250mg.

Structural formula: {0} (CAS {1})

9-oxofluorene-1-carbonyl chloride (CAS 55341-62-3) is a chemical compound with the molecular formula C14H7ClO2 and a molecular weight of 242.65 g/mol. IUPAC name: 9-oxofluorene-1-carbonyl chloride. InChIKey: ZNXLQKIGKKVHNF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H7ClO2
Molecular weight242.65 g/mol
IUPAC name9-oxofluorene-1-carbonyl chloride
InChIKeyZNXLQKIGKKVHNF-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C3=C(C2=O)C(=CC=C3)C(=O)Cl

Computed by PubChem (NCBI)