CAS 1310384-85-0 appears in our catalog under these names: (6-(4-Methyl-1H-pyrazol-1-yl)pyridin-2-yl)boronic acid, 95+%, 95+%, (6-(4-Methyl-1H-pyrazol-1-yl)pyridin-2-yl)boronic acid, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
[6-(4-methylpyrazol-1-yl)-2-pyridinyl]boronic acid (CAS 1310384-85-0) is a chemical compound with the molecular formula C9H10BN3O2 and a molecular weight of 203.01 g/mol. IUPAC name: [6-(4-methylpyrazol-1-yl)-2-pyridinyl]boronic acid. InChIKey: SOLIPWNQQFQWSI-UHFFFAOYSA-N.
| Molecular formula | C9H10BN3O2 |
|---|---|
| Molecular weight | 203.01 g/mol |
| IUPAC name | [6-(4-methylpyrazol-1-yl)-2-pyridinyl]boronic acid |
| InChIKey | SOLIPWNQQFQWSI-UHFFFAOYSA-N |
| SMILES | B(C1=NC(=CC=C1)N2C=C(C=N2)C)(O)O |
Computed by PubChem (NCBI)