CAS 2225169-51-5 is the registry number for 3–Methyl–1–(pyridin–2–yl)pyrazole–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
(3-methyl-1-pyridin-2-ylpyrazol-4-yl)boronic acid (CAS 2225169-51-5) is a chemical compound with the molecular formula C9H10BN3O2 and a molecular weight of 203.01 g/mol. IUPAC name: (3-methyl-1-pyridin-2-ylpyrazol-4-yl)boronic acid. InChIKey: WJQDWVDADOJXCB-UHFFFAOYSA-N.
| Molecular formula | C9H10BN3O2 |
|---|---|
| Molecular weight | 203.01 g/mol |
| IUPAC name | (3-methyl-1-pyridin-2-ylpyrazol-4-yl)boronic acid |
| InChIKey | WJQDWVDADOJXCB-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C)C2=CC=CC=N2)(O)O |
Computed by PubChem (NCBI)