CAS 2225174-27-4 appears in our catalog under these names: 3–Methyl–1–(pyridin–4–yl)pyrazole–4–boronic acid, (3-Methyl-1-(pyridin-4-yl)-1H-pyrazol-4-yl)boronic acid, >95%, >95%. Offered by: GLPBio, Chemat. Available pack sizes: 25mg, 5mg, 50mg, 100mg, 250mg, 1g.
(3-methyl-1-pyridin-4-ylpyrazol-4-yl)boronic acid (CAS 2225174-27-4) is a chemical compound with the molecular formula C9H10BN3O2 and a molecular weight of 203.01 g/mol. IUPAC name: (3-methyl-1-pyridin-4-ylpyrazol-4-yl)boronic acid. InChIKey: XXUGNMZBNWLNKU-UHFFFAOYSA-N.
| Molecular formula | C9H10BN3O2 |
|---|---|
| Molecular weight | 203.01 g/mol |
| IUPAC name | (3-methyl-1-pyridin-4-ylpyrazol-4-yl)boronic acid |
| InChIKey | XXUGNMZBNWLNKU-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1C)C2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)