Products 1310418-54-2
CAS 1310418-54-2 is the registry number for 1-Bromo-3,5-bis(1-methylethoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-3,5-di(propan-2-yloxy)benzene (CAS 1310418-54-2) is a chemical compound with the molecular formula C12H17BrO2 and a molecular weight of 273.17 g/mol. IUPAC name: 1-bromo-3,5-di(propan-2-yloxy)benzene. InChIKey: HJOZSJXZWZNSTJ-UHFFFAOYSA-N.
| Molecular formula | C12H17BrO2 |
|---|---|
| Molecular weight | 273.17 g/mol |
| IUPAC name | 1-bromo-3,5-di(propan-2-yloxy)benzene |
| InChIKey | HJOZSJXZWZNSTJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=CC(=C1)Br)OC(C)C |
Computed by PubChem (NCBI)