CAS 1310422-39-9 is the registry number for (S)-(4,7-Dihydro-5H-thieno[2,3-c]pyran-7-yl)methanamine hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methanamine;hydrochloride (CAS 1310422-39-9) is a chemical compound with the molecular formula C8H12ClNOS and a molecular weight of 205.71 g/mol. IUPAC name: [(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methanamine;hydrochloride. InChIKey: DZSYVXXKGUUHSI-FJXQXJEOSA-N.
| Molecular formula | C8H12ClNOS |
|---|---|
| Molecular weight | 205.71 g/mol |
| IUPAC name | [(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]methanamine;hydrochloride |
| InChIKey | DZSYVXXKGUUHSI-FJXQXJEOSA-N |
| SMILES | C1CO[C@H](C2=C1C=CS2)CN.Cl |
Computed by PubChem (NCBI)