Products 2200-41-1
CAS 2200-41-1 is the registry number for (±)​-S-​ethyl-​S-​phenyl-​sulfoximine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g.
Ethyl-imino-oxo-phenyl-lambda6-sulfane;hydrochloride (CAS 2200-41-1) is a chemical compound with the molecular formula C8H12ClNOS and a molecular weight of 205.71 g/mol. IUPAC name: ethyl-imino-oxo-phenyl-lambda6-sulfane;hydrochloride. InChIKey: LRPZFURIXZGTRZ-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNOS |
|---|---|
| Molecular weight | 205.71 g/mol |
| IUPAC name | ethyl-imino-oxo-phenyl-lambda6-sulfane;hydrochloride |
| InChIKey | LRPZFURIXZGTRZ-UHFFFAOYSA-N |
| SMILES | CCS(=N)(=O)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)