CAS 1797061-46-1 appears in our catalog under these names: 2-Methanesulfinyl-6-methylaniline hydrochloride, 95%, 2-Methanesulfinyl-6-methylaniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-methyl-6-methylsulfinylaniline;hydrochloride (CAS 1797061-46-1) is a chemical compound with the molecular formula C8H12ClNOS and a molecular weight of 205.71 g/mol. IUPAC name: 2-methyl-6-methylsulfinylaniline;hydrochloride. InChIKey: RBWZLTGWSACJKT-UHFFFAOYSA-N.
| Molecular formula | C8H12ClNOS |
|---|---|
| Molecular weight | 205.71 g/mol |
| IUPAC name | 2-methyl-6-methylsulfinylaniline;hydrochloride |
| InChIKey | RBWZLTGWSACJKT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)S(=O)C)N.Cl |
Computed by PubChem (NCBI)