CAS 1310422-41-3 appears in our catalog under these names: SEP-363856 hydrochloride/ 99.99%, SEP–363856 hydrochloride, SEP-363856 HCl 99%, (7S)-4,7-dihydro-N-methyl-5H-thieno[2,3-c]pyran-7-methanamine hydrochloride, Ulotaront (hydrochloride), 99.89%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
1-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]-N-methylmethanamine;hydrochloride (CAS 1310422-41-3) is a chemical compound with the molecular formula C9H14ClNOS and a molecular weight of 219.73 g/mol. IUPAC name: 1-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]-N-methylmethanamine;hydrochloride. InChIKey: JRDQGVVFSHRVTL-QRPNPIFTSA-N.
| Molecular formula | C9H14ClNOS |
|---|---|
| Molecular weight | 219.73 g/mol |
| IUPAC name | 1-[(7S)-5,7-dihydro-4H-thieno[2,3-c]pyran-7-yl]-N-methylmethanamine;hydrochloride |
| InChIKey | JRDQGVVFSHRVTL-QRPNPIFTSA-N |
| SMILES | CNC[C@H]1C2=C(CCO1)C=CS2.Cl |
Computed by PubChem (NCBI)