Products 2061996-54-9
CAS 2061996-54-9 appears in our catalog under these names: (S)-2-Amino-2-(3-(methylthio)phenyl)ethanol hydrochloride, 95%, (S)-2-Amino-2-(3-(methylthio)phenyl)ethanol hydrochloride, 97%, (S)–2–Amino–2–(3–(methylthio)phenyl)ethanol hydrochloride, (S)-2-Amino-2-(3-(methylthio)phenyl)ethanol hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(2S)-2-amino-2-(3-methylsulfanylphenyl)ethanol;hydrochloride (CAS 2061996-54-9) is a chemical compound with the molecular formula C9H14ClNOS and a molecular weight of 219.73 g/mol. IUPAC name: (2S)-2-amino-2-(3-methylsulfanylphenyl)ethanol;hydrochloride. InChIKey: FAKQQESIYANEIA-SBSPUUFOSA-N.
| Molecular formula | C9H14ClNOS |
|---|---|
| Molecular weight | 219.73 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-methylsulfanylphenyl)ethanol;hydrochloride |
| InChIKey | FAKQQESIYANEIA-SBSPUUFOSA-N |
| SMILES | CSC1=CC=CC(=C1)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)