CAS 1803596-13-5 appears in our catalog under these names: 1-{4H,6H,7H-thieno(3,2-c)pyran-4-yl}ethan-1-amine hydrochloride, 95%, 1-{4H,6H,7H-Thieno(3,2-c)pyran-4-yl}ethan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)ethanamine;hydrochloride (CAS 1803596-13-5) is a chemical compound with the molecular formula C9H14ClNOS and a molecular weight of 219.73 g/mol. IUPAC name: 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)ethanamine;hydrochloride. InChIKey: QGCKADHOFDLVKF-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNOS |
|---|---|
| Molecular weight | 219.73 g/mol |
| IUPAC name | 1-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)ethanamine;hydrochloride |
| InChIKey | QGCKADHOFDLVKF-UHFFFAOYSA-N |
| SMILES | CC(C1C2=C(CCO1)SC=C2)N.Cl |
Computed by PubChem (NCBI)