CAS 131068-72-9 appears in our catalog under these names: 2-Hydroxy-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)acetamide, Metolachlor-2-hydroxy 100 µg/mL in Acetonitrile, Metolachlor-2-hydroxy, Concentration: 1000 µg/ml Solvent: Methanol, Metolachlor-2-hydroxy, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 1g, 1ml, 1x1ml.
N-(2-ethyl-6-methylphenyl)-2-hydroxy-N-(1-methoxypropan-2-yl)acetamide (CAS 131068-72-9) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: N-(2-ethyl-6-methylphenyl)-2-hydroxy-N-(1-methoxypropan-2-yl)acetamide. InChIKey: YRHZCHBPHOEWCA-UHFFFAOYSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | N-(2-ethyl-6-methylphenyl)-2-hydroxy-N-(1-methoxypropan-2-yl)acetamide |
| InChIKey | YRHZCHBPHOEWCA-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC(=C1N(C(C)COC)C(=O)CO)C |
Computed by PubChem (NCBI)