CAS 1310680-16-0 is the registry number for 2,4-Dichloro-5-(trifluoromethyl)-7H-pyrrolo(2,3-d)pyrimidine, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
2,4-dichloro-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine (CAS 1310680-16-0) is a chemical compound with the molecular formula C7H2Cl2F3N3 and a molecular weight of 256.01 g/mol. IUPAC name: 2,4-dichloro-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: OJJAWQHRKJTAAA-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3N3 |
|---|---|
| Molecular weight | 256.01 g/mol |
| IUPAC name | 2,4-dichloro-5-(trifluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | OJJAWQHRKJTAAA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)N=C(N=C2Cl)Cl)C(F)(F)F |
Computed by PubChem (NCBI)