CAS 1823182-47-3 is the registry number for 3,8-Dichloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3,8-dichloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine (CAS 1823182-47-3) is a chemical compound with the molecular formula C7H2Cl2F3N3 and a molecular weight of 256.01 g/mol. IUPAC name: 3,8-dichloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: URAZUISWJKARQW-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3N3 |
|---|---|
| Molecular weight | 256.01 g/mol |
| IUPAC name | 3,8-dichloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | URAZUISWJKARQW-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NN=C(N2C=C1C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)