CAS 1422701-22-1 appears in our catalog under these names: 4,6-Dichloro-2-(trifluoromethyl)-1H-imidazo(4,5-c)pyridine, 97%, 4,6-Dichloro-2-(trifluoromethyl)-1H-imidazo(4,5-c)pyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4,6-dichloro-2-(trifluoromethyl)-1H-imidazo[4,5-c]pyridine (CAS 1422701-22-1) is a chemical compound with the molecular formula C7H2Cl2F3N3 and a molecular weight of 256.01 g/mol. IUPAC name: 4,6-dichloro-2-(trifluoromethyl)-1H-imidazo[4,5-c]pyridine. InChIKey: HFDUOHSUGAAACF-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl2F3N3 |
|---|---|
| Molecular weight | 256.01 g/mol |
| IUPAC name | 4,6-dichloro-2-(trifluoromethyl)-1H-imidazo[4,5-c]pyridine |
| InChIKey | HFDUOHSUGAAACF-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(N=C1Cl)Cl)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)