CAS 1311254-94-0 appears in our catalog under these names: (R)-1-(3-Fluororopyridin-2-yl)ethylamine Hydrochloride, (R)-1-(3-Fluororopyridin-2-yl)ethylamine- Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 500mg.
(1R)-1-(3-fluoro-2-pyridinyl)ethanamine;hydrochloride (CAS 1311254-94-0) is a chemical compound with the molecular formula C7H10ClFN2 and a molecular weight of 176.62 g/mol. IUPAC name: (1R)-1-(3-fluoro-2-pyridinyl)ethanamine;hydrochloride. InChIKey: MPEHHZCSUKROFX-NUBCRITNSA-N.
| Molecular formula | C7H10ClFN2 |
|---|---|
| Molecular weight | 176.62 g/mol |
| IUPAC name | (1R)-1-(3-fluoro-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | MPEHHZCSUKROFX-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=CC=N1)F)N.Cl |
Computed by PubChem (NCBI)