CAS 1346617-37-5 is the registry number for (R)-1-(3-Fluororopyridin-2-yl)ethylamine-d3 Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 5mg.
(1R)-2,2,2-trideuterio-1-(3-fluoro-2-pyridinyl)ethanamine;hydrochloride (CAS 1346617-37-5) is a chemical compound with the molecular formula C7H10ClFN2 and a molecular weight of 179.64 g/mol. IUPAC name: (1R)-2,2,2-trideuterio-1-(3-fluoro-2-pyridinyl)ethanamine;hydrochloride. InChIKey: MPEHHZCSUKROFX-HRYRFEROSA-N.
| Molecular formula | C7H10ClFN2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (1R)-2,2,2-trideuterio-1-(3-fluoro-2-pyridinyl)ethanamine;hydrochloride |
| InChIKey | MPEHHZCSUKROFX-HRYRFEROSA-N |
| SMILES | [2H]C([2H])([2H])[C@H](C1=C(C=CC=N1)F)N.Cl |
Computed by PubChem (NCBI)