Products 1311265-17-4

CAS 1311265-17-4 is the registry number for 1-[(4-Bromophenoxy)methyl]cyclopropanecarboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 1-[(4-bromophenoxy)methyl]cyclopropane-1-carboxylate (CAS 1311265-17-4) is a chemical compound with the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. IUPAC name: ethyl 1-[(4-bromophenoxy)methyl]cyclopropane-1-carboxylate. InChIKey: LBOAXSVJAYVQEA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15BrO3
Molecular weight299.16 g/mol
IUPAC nameethyl 1-[(4-bromophenoxy)methyl]cyclopropane-1-carboxylate
InChIKeyLBOAXSVJAYVQEA-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC1)COC2=CC=C(C=C2)Br

Computed by PubChem (NCBI)