CAS 951885-61-3 is the registry number for 1-(3-Bromobenzyl)-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-[(3-bromophenyl)methyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane (CAS 951885-61-3) is a chemical compound with the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. IUPAC name: 1-[(3-bromophenyl)methyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane. InChIKey: QJWQIXCPAVGZDM-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO3 |
|---|---|
| Molecular weight | 299.16 g/mol |
| IUPAC name | 1-[(3-bromophenyl)methyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane |
| InChIKey | QJWQIXCPAVGZDM-UHFFFAOYSA-N |
| SMILES | CC12COC(OC1)(OC2)CC3=CC(=CC=C3)Br |
Computed by PubChem (NCBI)