CAS 210880-38-9 is the registry number for Benzyl 4-bromo-2,2-dimethyl-3-oxobutanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 4-bromo-2,2-dimethyl-3-oxobutanoate (CAS 210880-38-9) is a chemical compound with the molecular formula C13H15BrO3 and a molecular weight of 299.16 g/mol. IUPAC name: benzyl 4-bromo-2,2-dimethyl-3-oxobutanoate. InChIKey: RNKFKAXFSGDIHU-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO3 |
|---|---|
| Molecular weight | 299.16 g/mol |
| IUPAC name | benzyl 4-bromo-2,2-dimethyl-3-oxobutanoate |
| InChIKey | RNKFKAXFSGDIHU-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)CBr)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)