Products 1311315-06-6
CAS 1311315-06-6 appears in our catalog under these names: 2-amino-N-(cyclobutylmethyl)ethane-1-sulfonamide hydrochloride, 98%, 2-Amino-N-(cyclobutylmethyl)ethane-1-sulfonamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 0,5g, 50mg.
2-amino-N-(cyclobutylmethyl)ethanesulfonamide;hydrochloride (CAS 1311315-06-6) is a chemical compound with the molecular formula C7H17ClN2O2S and a molecular weight of 228.74 g/mol. IUPAC name: 2-amino-N-(cyclobutylmethyl)ethanesulfonamide;hydrochloride. InChIKey: HPPMSHXHBKJLAP-UHFFFAOYSA-N.
| Molecular formula | C7H17ClN2O2S |
|---|---|
| Molecular weight | 228.74 g/mol |
| IUPAC name | 2-amino-N-(cyclobutylmethyl)ethanesulfonamide;hydrochloride |
| InChIKey | HPPMSHXHBKJLAP-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CNS(=O)(=O)CCN.Cl |
Computed by PubChem (NCBI)