CAS 1311315-38-4 appears in our catalog under these names: 1-(2,4-Dichloro-5-fluorophenyl)ethan-1-amine hydrochloride, 95%, 1-(2,4-Dichloro-5-fluorophenyl)ethan-1-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
1-(2,4-dichloro-5-fluorophenyl)ethanamine;hydrochloride (CAS 1311315-38-4) is a chemical compound with the molecular formula C8H9Cl3FN and a molecular weight of 244.5 g/mol. IUPAC name: 1-(2,4-dichloro-5-fluorophenyl)ethanamine;hydrochloride. InChIKey: OPFAKCCCEVMAOR-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl3FN |
|---|---|
| Molecular weight | 244.5 g/mol |
| IUPAC name | 1-(2,4-dichloro-5-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | OPFAKCCCEVMAOR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1Cl)Cl)F)N.Cl |
Computed by PubChem (NCBI)