CAS 2138222-52-1 is the registry number for 1-(3,5-Dichloro-2-fluorophenyl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(3,5-dichloro-2-fluorophenyl)ethanamine;hydrochloride (CAS 2138222-52-1) is a chemical compound with the molecular formula C8H9Cl3FN and a molecular weight of 244.5 g/mol. IUPAC name: 1-(3,5-dichloro-2-fluorophenyl)ethanamine;hydrochloride. InChIKey: CZWOAPSGGHUTDC-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl3FN |
|---|---|
| Molecular weight | 244.5 g/mol |
| IUPAC name | 1-(3,5-dichloro-2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | CZWOAPSGGHUTDC-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C(=CC(=C1)Cl)Cl)F)N.Cl |
Computed by PubChem (NCBI)