CAS 960053-41-2 appears in our catalog under these names: 2–(2,4–Dichlorophenyl)–2–fluoroethanamine hydrochloride, 2-(2,4-Dichlorophenyl)-2-fluoroethanamine hydrochloride, 97%, 2-(2,4-Dichlorophenyl)-2-fluoroethanamine hydrochloride, 97%, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,4-dichlorophenyl)-2-fluoroethanamine;hydrochloride (CAS 960053-41-2) is a chemical compound with the molecular formula C8H9Cl3FN and a molecular weight of 244.5 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-fluoroethanamine;hydrochloride. InChIKey: PBEKPQSMDQIZFJ-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl3FN |
|---|---|
| Molecular weight | 244.5 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-fluoroethanamine;hydrochloride |
| InChIKey | PBEKPQSMDQIZFJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CN)F.Cl |
Computed by PubChem (NCBI)