Products 1311317-29-9

CAS 1311317-29-9 is the registry number for tert-Butyl 4-((hydrazinecarbonyl)amino)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(hydrazinecarbonylamino)piperidine-1-carboxylate (CAS 1311317-29-9) is a chemical compound with the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. IUPAC name: tert-butyl 4-(hydrazinecarbonylamino)piperidine-1-carboxylate. InChIKey: MMIVXIUUDRGKAU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22N4O3
Molecular weight258.32 g/mol
IUPAC nametert-butyl 4-(hydrazinecarbonylamino)piperidine-1-carboxylate
InChIKeyMMIVXIUUDRGKAU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)NC(=O)NN

Computed by PubChem (NCBI)